27554-26-3 diisooctyl phthalate
Naam product |
diisooctyl phthalate |
Engelse naam |
diisooctyl phthalate; diisooctyl phthalate, mixed isomers; diiso-octyl phthalate; diiso-octyl orthophthalate; 1,2-Benzenedicarboxylic Acid Diisoctyl Ester; Di-iso-octyl phthalate; bis(6-methylheptyl) benzene-1,2-dicarboxylate; Phthalate Dioctyl |
MF |
C24H38O4 |
Molecuulgewicht |
390.5561 |
InChI |
InChI=1/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3 |
CAS-nummer |
27554-26-3 |
EINECS |
248-523-5 |
Moleculaire Structuur |
|
Dichtheid |
0.983g/cm3 |
Kookpunt |
384.9°C at 760 mmHg |
Brekingsindex |
1.488 |
Vlampunt |
204.5°C |
Dampdruk |
3.95E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R2:Risk of explosion by shock, friction, fire or other sources of ignition.;
R24/25:Toxic in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S2:;
S24/25:;
|
|