| Naam product |
4-(2,4-dichloorfenoxy)boterzuur, verbinding met dimethylamine (1:1) |
| Synoniemen |
2,4-DB-dimethylammonium [ISO]; 2,4-DB dimethylaminezout; 2,4-DB-dimethylammonium; 4-(2,4-dichloorfenoxy)boterzuurdimethylaminezout; CCRIS 8800; Caswell: Nee.316 quater; EPA Pesticide Chemische Code 030819; 4-(2,4-dichloorfenoxy)boterzuur, verbinding met dimethylamine (1:1); Butaanzuur, 4-(2,4-dichloorfenoxy)-, compd.met N-methylmethanamine (1:1); Boterzuur, 4-(2,4-dichloorfenoxy)-, dimethylaminezout; Dimethylamine-4-(2,4-dichloorfenoxy)butyraat; 4-(2,4-dichloorfenoxy)butaanzuur - N-methylmethanamine (1:1) |
| Engelse naam |
4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1);2,4-DB-dimethylammonium [ISO]; 2,4-DB dimethylamine salt; 2,4-DB-Dimethylammonium; 4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt; CCRIS 8800; Caswell No. 316C; EPA Pesticide Chemical Code 030819; 4-(2,4-Dichlorophenoxy)butyric acid, compound with dimethylamine (1:1); Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1); Butyric acid, 4-(2,4-dichlorophenoxy)-, dimethylamine salt; Dimethylamine 4-(2,4-dichlorophenoxy)butyrate; 4-(2,4-dichlorophenoxy)butanoic acid - N-methylmethanamine (1:1) |
| MF |
C12H17Cl2NO3 |
| Molecuulgewicht |
294.1743 |
| InChI |
InChI=1/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
| CAS-nummer |
2758-42-1 |
| EINECS |
220-422-0 |
| Moleculaire Structuur |
|
| Kookpunt |
410.4°C at 760 mmHg |
| Vlampunt |
202°C |
| Dampdruk |
1.8E-07mmHg at 25°C |
|