ChemNet > CAS > 27738-46-1 3,4-(methyleendioxy)amandelzuur
27738-46-1 3,4-(methyleendioxy)amandelzuur
| Naam product |
3,4-(methyleendioxy)amandelzuur |
| Synoniemen |
alfa-hydroxy-1,3-benzodioxol-5-azijnzuur; 1,3-benzodioxol-5-glycolzuur; 1,3-benzodioxol-5-yl(hydroxy)azijnzuur; (2S)-1,3-benzodioxol-5-yl(hydroxy)ethanoaat |
| Engelse naam |
3,4-(Methylenedioxy)mandelic acid; alpha-Hydroxy-1,3-benzodioxole-5-acetic acid; 1,3-Benzodioxole-5-glycollic acid; 1,3-benzodioxol-5-yl(hydroxy)acetic acid; (2S)-1,3-benzodioxol-5-yl(hydroxy)ethanoate |
| MF |
C9H7O5 |
| Molecuulgewicht |
195.1494 |
| InChI |
InChI=1/C9H8O5/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8,10H,4H2,(H,11,12)/p-1/t8-/m0/s1 |
| CAS-nummer |
27738-46-1 |
| EINECS |
248-628-6 |
| Moleculaire Structuur |
|
| Kookpunt |
403.5°C at 760 mmHg |
| Vlampunt |
169.2°C |
| Dampdruk |
3.1E-07mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|