2778-96-3 stearyl stearate
Naam product |
stearyl stearate |
Engelse naam |
stearyl stearate; stearic acid stearyl ester; octadecyl octadecanoate |
MF |
C36H72O2 |
Molecuulgewicht |
536.9557 |
InChI |
InChI=1/C36H72O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-35H2,1-2H3 |
CAS-nummer |
2778-96-3 |
EINECS |
220-476-5 |
Moleculaire Structuur |
|
Dichtheid |
0.857g/cm3 |
Kookpunt |
549.1°C at 760 mmHg |
Brekingsindex |
1.457 |
Vlampunt |
297°C |
Dampdruk |
4.14E-12mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|