ChemNet > CAS > 27829-72-7 ethyl trans-2-hexenoate
27829-72-7 ethyl trans-2-hexenoate
Naam product |
ethyl trans-2-hexenoate |
Engelse naam |
ethyl trans-2-hexenoate; trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
MF |
C8H14O2 |
Molecuulgewicht |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
CAS-nummer |
27829-72-7 |
EINECS |
248-681-5 |
Moleculaire Structuur |
|
Dichtheid |
0.901g/cm3 |
Kookpunt |
172.6°C at 760 mmHg |
Brekingsindex |
1.432 |
Vlampunt |
62.3°C |
Dampdruk |
1.32mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|