ChemNet > CAS > 280556-71-0 (4-morpholinophenyl)methanol
280556-71-0 (4-morpholinophenyl)methanol
| Naam product |
(4-morpholinophenyl)methanol |
| Engelse naam |
(4-morpholinophenyl)methanol; (4-Morpholin-4-yl-phenyl)-methanol |
| MF |
C11H15NO2 |
| Molecuulgewicht |
193.2423 |
| InChI |
InChI=1/C11H15NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
| CAS-nummer |
280556-71-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.16g/cm3 |
| Kookpunt |
378.4°C at 760 mmHg |
| Brekingsindex |
1.568 |
| Vlampunt |
182.7°C |
| Dampdruk |
2.12E-06mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
