ChemNet > CAS > 2849-93-6 1H-benzimidazole-2-carboxylic acid
2849-93-6 1H-benzimidazole-2-carboxylic acid
Naam product |
1H-benzimidazole-2-carboxylic acid |
Engelse naam |
1H-benzimidazole-2-carboxylic acid; 2-Benzimidazolecarboxylic acid |
MF |
C8H6N2O2 |
Molecuulgewicht |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c11-8(12)7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)(H,11,12) |
CAS-nummer |
2849-93-6 |
Moleculaire Structuur |
|
Dichtheid |
1.507g/cm3 |
Smeltpunt |
169℃ |
Kookpunt |
443.991°C at 760 mmHg |
Brekingsindex |
1.743 |
Vlampunt |
222.318°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|