286-99-7 Cyclododecane epoxide
| Naam product |
Cyclododecane epoxide |
| Engelse naam |
Cyclododecane epoxide; Cyclododecane epoxide, mixture of cis andtrans isomers; Cyclododecene oxide (cis+trans); Cyclododecane oxide; Epoxy N-Dodecane; 13-oxabicyclo[10.1.0]tridecane; (1R,12R)-13-oxabicyclo[10.1.0]tridecane; (1R,12S)-13-oxabicyclo[10.1.0]tridecane; (1S,12S)-13-oxabicyclo[10.1.0]tridecane |
| MF |
C12H22O |
| Molecuulgewicht |
182.3025 |
| InChI |
InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
| CAS-nummer |
286-99-7 |
| EINECS |
206-012-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.899g/cm3 |
| Smeltpunt |
-7℃ |
| Kookpunt |
237.4°C at 760 mmHg |
| Brekingsindex |
1.455 |
| Vlampunt |
82.2°C |
| Dampdruk |
0.0691mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R38:;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|