ChemNet > CAS > 2893-05-2 3-Methyl-1-phenyl-2-butanone
2893-05-2 3-Methyl-1-phenyl-2-butanone
Naam product |
3-Methyl-1-phenyl-2-butanone |
Engelse naam |
3-Methyl-1-phenyl-2-butanone; Benzyl isopropyl ketone; 3-methyl-1-phenylbutan-2-one |
MF |
C11H14O |
Molecuulgewicht |
162.2283 |
InChI |
InChI=1/C11H14O/c1-9(2)11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
CAS-nummer |
2893-05-2 |
EINECS |
220-765-6 |
Moleculaire Structuur |
|
Dichtheid |
0.958g/cm3 |
Kookpunt |
237°C at 760 mmHg |
Brekingsindex |
1.498 |
Vlampunt |
93.2°C |
Dampdruk |
0.0459mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|