ChemNet > CAS > 29682-41-5 1,4-Dichloro-2-iodobenzene
29682-41-5 1,4-Dichloro-2-iodobenzene
| Naam product |
1,4-Dichloro-2-iodobenzene |
| Engelse naam |
1,4-Dichloro-2-iodobenzene; 2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
| MF |
C6H3Cl2I |
| Molecuulgewicht |
272.8985 |
| InChI |
InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| CAS-nummer |
29682-41-5 |
| EINECS |
249-774-3 |
| Moleculaire Structuur |
|
| Dichtheid |
2.015g/cm3 |
| Smeltpunt |
21-257℃ |
| Kookpunt |
255.5°C at 760 mmHg |
| Brekingsindex |
1.642 |
| Vlampunt |
93.9°C |
| Dampdruk |
0.026mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
