3019-20-3 Isopropylthiobenzene
Naam product |
Isopropylthiobenzene |
Engelse naam |
Isopropylthiobenzene; (Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
MF |
C9H12S |
Molecuulgewicht |
152.2566 |
InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
CAS-nummer |
3019-20-3 |
EINECS |
221-162-0 |
Moleculaire Structuur |
|
Dichtheid |
0.98g/cm3 |
Kookpunt |
208°C at 760 mmHg |
Brekingsindex |
1.544 |
Vlampunt |
83.2°C |
Dampdruk |
0.315mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|