ChemNet > CAS > 3033-62-3 N,N,N',N'-tetramethyl-2,2'-oxybis(ethylamine)
3033-62-3 N,N,N',N'-tetramethyl-2,2'-oxybis(ethylamine)
| Naam product |
N,N,N',N'-tetramethyl-2,2'-oxybis(ethylamine) |
| Engelse naam |
N,N,N',N'-tetramethyl-2,2'-oxybis(ethylamine); N,N,N,N-Tetramethyl-2,2-Oxy Bis (Ethylamine); Bis(2-dimethylaminoethyl) ether; A-1; JSPC-1 CATYLIST; bis(2-dimethylamine)ethyl; Bis (2-dimethylaminoethyl) ether; 2,2'-oxybis(N,N-dimethylethanamine); Bis(2-dimethylaminoethyl)ether; Bls(2-Dlmethylamlno Ethyl) Ether; BDMAEE |
| MF |
C8H20N2O |
| Molecuulgewicht |
160.2572 |
| InChI |
InChI=1/C8H20N2O/c1-9(2)5-7-11-8-6-10(3)4/h5-8H2,1-4H3 |
| CAS-nummer |
3033-62-3 |
| EINECS |
221-220-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.883g/cm3 |
| Kookpunt |
194.8°C at 760 mmHg |
| Brekingsindex |
1.445 |
| Vlampunt |
46.2°C |
| Dampdruk |
0.433mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R22:Harmful if swallowed.;
R23/24:Toxic by inhalation and in contact with skin.;
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
