3033-82-7 8-Chloroquinaldine
Naam product |
8-Chloroquinaldine |
Engelse naam |
8-Chloroquinaldine; 8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
MF |
C10H8ClN |
Molecuulgewicht |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
CAS-nummer |
3033-82-7 |
Moleculaire Structuur |
|
Dichtheid |
1.225g/cm3 |
Smeltpunt |
64-66℃ |
Kookpunt |
278.2°C at 760 mmHg |
Brekingsindex |
1.634 |
Vlampunt |
148.7°C |
Dampdruk |
0.00732mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|