ChemNet > CAS > 306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
Naam product |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
Engelse naam |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde; 6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
MF |
C9H7FO3 |
Molecuulgewicht |
182.1485 |
InChI |
InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
CAS-nummer |
306934-87-2 |
Moleculaire Structuur |
|
Dichtheid |
1.357g/cm3 |
Smeltpunt |
116℃ |
Kookpunt |
323.051°C at 760 mmHg |
Brekingsindex |
1.566 |
Vlampunt |
144.319°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|