ChemNet > CAS > 30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
| Naam product |
5-nitro-2-pyrrolidin-1-yl-benzaldehyde |
| Engelse naam |
5-nitro-2-pyrrolidin-1-yl-benzaldehyde; |
| MF |
C11H12N2O3 |
| Molecuulgewicht |
220.2246 |
| InChI |
InChI=1/C11H12N2O3/c14-8-9-7-10(13(15)16)3-4-11(9)12-5-1-2-6-12/h3-4,7-8H,1-2,5-6H2 |
| CAS-nummer |
30742-59-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.314g/cm3 |
| Smeltpunt |
136℃ |
| Kookpunt |
402.1°C at 760 mmHg |
| Brekingsindex |
1.632 |
| Vlampunt |
197°C |
| Dampdruk |
1.13E-06mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
