ChemNet > CAS > 3085-42-5 4-Chlorophenyl sulfoxide
3085-42-5 4-Chlorophenyl sulfoxide
| Naam product |
4-Chlorophenyl sulfoxide |
| Engelse naam |
4-Chlorophenyl sulfoxide; Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
| MF |
C12H8Cl2OS |
| Molecuulgewicht |
271.1623 |
| InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
| CAS-nummer |
3085-42-5 |
| EINECS |
221-397-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.48g/cm3 |
| Smeltpunt |
140-145℃ |
| Kookpunt |
406.2°C at 760 mmHg |
| Brekingsindex |
1.689 |
| Vlampunt |
199.5°C |
| Dampdruk |
1.94E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
