ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| Naam product |
2-Acetyl-5-iodothiophene |
| Engelse naam |
2-Acetyl-5-iodothiophene;NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| MF |
C6H5IOS |
| Molecuulgewicht |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| CAS-nummer |
30955-94-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.902g/cm3 |
| Kookpunt |
306.2°C at 760 mmHg |
| Brekingsindex |
1.637 |
| Vlampunt |
139°C |
| Dampdruk |
0.000785mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
