ChemNet > CAS > 3096-57-9 2-Amino-9-fluorenone
3096-57-9 2-Amino-9-fluorenone
| Naam product |
2-Amino-9-fluorenone |
| Engelse naam |
2-Amino-9-fluorenone; Aminofluorenone; 2-amino-9H-fluoren-9-one |
| MF |
C13H9NO |
| Molecuulgewicht |
195.2167 |
| InChI |
InChI=1/C13H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H,14H2 |
| CAS-nummer |
3096-57-9 |
| EINECS |
221-445-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.327g/cm3 |
| Smeltpunt |
152-157℃ |
| Kookpunt |
426.4°C at 760 mmHg |
| Brekingsindex |
1.72 |
| Vlampunt |
211.7°C |
| Dampdruk |
1.77E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
