ChemNet > CAS > 31366-25-3 Tetrathiafulvalene
31366-25-3 Tetrathiafulvalene
| Naam product |
Tetrathiafulvalene |
| Engelse naam |
Tetrathiafulvalene; delta2,2-Bi-1,3-dithiole; TTF; TetrathiafulvaleneTTForangextl; delta-2:2-bis(1,3-dithiazole); DELTA^2^,^2^-Bi-1,3-dithiole~TTF; 2-(1,3-dithiol-2-ylidene)-1,3-dithiole |
| MF |
C6H4S4 |
| Molecuulgewicht |
204.356 |
| InChI |
InChI=1/C6H4S4/c1-2-8-5(7-1)6-9-3-4-10-6/h1-4H |
| CAS-nummer |
31366-25-3 |
| EINECS |
250-593-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.636g/cm3 |
| Smeltpunt |
117-120℃ |
| Kookpunt |
229°C at 760 mmHg |
| Brekingsindex |
1.879 |
| Vlampunt |
120.9°C |
| Dampdruk |
0.107mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
