ChemNet > CAS > 3138-86-1 2,3-Bis(bromomethyl)quinoxaline
3138-86-1 2,3-Bis(bromomethyl)quinoxaline
Naam product |
2,3-Bis(bromomethyl)quinoxaline |
Engelse naam |
2,3-Bis(bromomethyl)quinoxaline; 2,3-Bis-(bromethyl)-quinoxaline 98% |
MF |
C10H8Br2N2 |
Molecuulgewicht |
315.9919 |
InChI |
InChI=1/C10H8Br2N2/c11-5-9-10(6-12)14-8-4-2-1-3-7(8)13-9/h1-4H,5-6H2 |
CAS-nummer |
3138-86-1 |
EINECS |
221-538-4 |
Moleculaire Structuur |
|
Dichtheid |
1.869g/cm3 |
Smeltpunt |
150-154℃ |
Kookpunt |
345.7°C at 760 mmHg |
Brekingsindex |
1.703 |
Vlampunt |
162.9°C |
Dampdruk |
0.000121mmHg at 25°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|