3141-25-1 2,3,4-Tribromothiophene
Naam product |
2,3,4-Tribromothiophene |
Engelse naam |
2,3,4-Tribromothiophene; |
MF |
C4HBr3S |
Molecuulgewicht |
320.8277 |
InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
CAS-nummer |
3141-25-1 |
EINECS |
221-545-2 |
Moleculaire Structuur |
|
Dichtheid |
2.516g/cm3 |
Kookpunt |
277.5°C at 760 mmHg |
Brekingsindex |
1.671 |
Vlampunt |
121.6°C |
Dampdruk |
0.00762mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|