ChemNet > CAS > 31431-13-7 Cyclobutyl-4-fluorophenyl ketone
31431-13-7 Cyclobutyl-4-fluorophenyl ketone
| Naam product |
Cyclobutyl-4-fluorophenyl ketone |
| Engelse naam |
Cyclobutyl-4-fluorophenyl ketone;Cyclobutyl 4-fluorophenyl ketone; cyclobutyl(4-fluorophenyl)methanone |
| MF |
C11H11FO |
| Molecuulgewicht |
178.2028 |
| InChI |
InChI=1/C11H11FO/c12-10-6-4-9(5-7-10)11(13)8-2-1-3-8/h4-8H,1-3H2 |
| CAS-nummer |
31431-13-7 |
| EINECS |
250-628-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.17g/cm3 |
| Kookpunt |
268°C at 760 mmHg |
| Brekingsindex |
1.544 |
| Vlampunt |
107.2°C |
| Dampdruk |
0.00789mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
