ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
Naam product |
Methyl 2,4,6-trihydroxybenzoate |
Engelse naam |
Methyl 2,4,6-trihydroxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
MF |
C8H8O5 |
Molecuulgewicht |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
CAS-nummer |
3147-39-5 |
EINECS |
221-566-7 |
Moleculaire Structuur |
|
Dichtheid |
1.501g/cm3 |
Smeltpunt |
174-176℃ |
Kookpunt |
359.5°C at 760 mmHg |
Brekingsindex |
1.63 |
Vlampunt |
150.3°C |
Dampdruk |
1.14E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|