ChemNet > CAS > 32358-91-1 5-propionyl-2,2'-bithienyl
32358-91-1 5-propionyl-2,2'-bithienyl
Naam product |
5-propionyl-2,2'-bithienyl |
Synoniemen |
1-(2,2-bithiofen-5-yl)propaan-1-on |
Engelse naam |
5-Propionyl-2,2'-bithienyl; 1-(2,2-Bithiophen-5-yl)propan-1-one |
MF |
C11H10OS2 |
Molecuulgewicht |
222.3265 |
InChI |
InChI=1/C11H10OS2/c1-2-8(12)9-5-6-11(14-9)10-4-3-7-13-10/h3-7H,2H2,1H3 |
CAS-nummer |
32358-91-1 |
Moleculaire Structuur |
|
Dichtheid |
1.223g/cm3 |
Kookpunt |
373.7°C at 760 mmHg |
Brekingsindex |
1.601 |
Vlampunt |
179.8°C |
Dampdruk |
8.78E-06mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|