ChemNet > CAS > 32477-35-3 heptafluorobutyrylimidazole
32477-35-3 heptafluorobutyrylimidazole
Naam product |
heptafluorobutyrylimidazole |
Engelse naam |
heptafluorobutyrylimidazole; N-Heptafluorobutyrylimidazole; 4'-fluorobiphenyl-4-amine hydrochloride (1:1) |
MF |
C12H11ClFN |
Molecuulgewicht |
223.6738 |
InChI |
InChI=1/C12H10FN.ClH/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H,14H2;1H |
CAS-nummer |
32477-35-3 |
EINECS |
251-063-8 |
Moleculaire Structuur |
|
Kookpunt |
306.6°C at 760 mmHg |
Vlampunt |
158°C |
Dampdruk |
0.000762mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|