ChemNet > CAS > 3261-87-8 Thiodiglycolic anhydride
3261-87-8 Thiodiglycolic anhydride
| Naam product |
Thiodiglycolic anhydride |
| Engelse naam |
Thiodiglycolic anhydride; 1,4-Oxathiane-2,6-dione; 2,2-Thiodiacetic acid anhydride; 1,4-oxathiane-2,6-dione |
| MF |
C4H4O3S |
| Molecuulgewicht |
132.1378 |
| InChI |
InChI=1/C4H4O3S/c5-3-1-8-2-4(6)7-3/h1-2H2 |
| CAS-nummer |
3261-87-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.468g/cm3 |
| Smeltpunt |
93-94℃ |
| Kookpunt |
341.8°C at 760 mmHg |
| Brekingsindex |
1.545 |
| Vlampunt |
190.5°C |
| Dampdruk |
7.86E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
