ChemNet > CAS > 3289-28-9 Ethyl Cyclohexanecarboxylate
3289-28-9 Ethyl Cyclohexanecarboxylate
| Naam product |
Ethyl Cyclohexanecarboxylate |
| Engelse naam |
Ethyl Cyclohexanecarboxylate; Cyclohexanecarboxylic acid ethyl ester; Ethyl cyclohexane carboxylate |
| MF |
C9H16O2 |
| Molecuulgewicht |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-2-11-9(10)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
| CAS-nummer |
3289-28-9 |
| EINECS |
221-945-7 |
| Moleculaire Structuur |
|
| Dichtheid |
0.972g/cm3 |
| Kookpunt |
197.1°C at 760 mmHg |
| Brekingsindex |
1.451 |
| Vlampunt |
68.5°C |
| Dampdruk |
0.385mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
