33155-90-7 Hydroxybenzoquinoline
Naam product |
Hydroxybenzoquinoline |
Engelse naam |
Hydroxybenzoquinoline; 10-Hydroxybenzo[h]quinoline; benzo[h]quinolin-10-ol |
MF |
C13H9NO |
Molecuulgewicht |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
CAS-nummer |
33155-90-7 |
Moleculaire Structuur |
|
Dichtheid |
1.307g/cm3 |
Kookpunt |
420.621°C at 760 mmHg |
Brekingsindex |
1.768 |
Vlampunt |
208.184°C |
Dampdruk |
0mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|