ChemNet > CAS > 3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone
Naam product |
3',5'-dichloro-2'-hydroxyacetophenone |
Engelse naam |
3',5'-dichloro-2'-hydroxyacetophenone; 3,5-Dichloro-2-hydroxyacetophenone; 1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
MF |
C8H6Cl2O2 |
Molecuulgewicht |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
CAS-nummer |
3321-92-4 |
Moleculaire Structuur |
|
Dichtheid |
1.43g/cm3 |
Smeltpunt |
94-97℃ |
Kookpunt |
295.6°C at 760 mmHg |
Brekingsindex |
1.583 |
Vlampunt |
132.6°C |
Dampdruk |
0.000856mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|