3325-11-9 5-Aminobenzotriazole
Naam product |
5-Aminobenzotriazole |
Engelse naam |
5-Aminobenzotriazole;1H-Benzotriazol-6-amine; 1H-Benzotriazol-5-amine; 2H-benzotriazol-5-amine |
MF |
C6H6N4 |
Molecuulgewicht |
134.1386 |
InChI |
InChI=1/C6H6N4/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,7H2,(H,8,9,10) |
CAS-nummer |
3325-11-9 |
Moleculaire Structuur |
|
Dichtheid |
1.48g/cm3 |
Kookpunt |
387.4°C at 760 mmHg |
Brekingsindex |
1.806 |
Vlampunt |
216.5°C |
Dampdruk |
3.29E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|