ChemNet > CAS > 33265-60-0 1-(2-Nitrophenyl)pyrrole
33265-60-0 1-(2-Nitrophenyl)pyrrole
| Naam product |
1-(2-Nitrophenyl)pyrrole |
| Engelse naam |
1-(2-Nitrophenyl)pyrrole;1-(2-nitrophenyl)-1H-pyrrolato(2-) |
| MF |
C10H8N2O2 |
| Molecuulgewicht |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c13-12(14)10-6-2-1-5-9(10)11-7-3-4-8-11/h1-8H |
| CAS-nummer |
33265-60-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.23g/cm3 |
| Smeltpunt |
58-60℃ |
| Kookpunt |
328.5°C at 760 mmHg |
| Brekingsindex |
1.613 |
| Vlampunt |
152.5°C |
| Dampdruk |
0.000361mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
