ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
Naam product |
Methyl methylsulfinylmethyl sulfide |
Engelse naam |
Methyl methylsulfinylmethyl sulfide; Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
MF |
C3H8OS2 |
Molecuulgewicht |
124.225 |
InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
CAS-nummer |
33577-16-1 |
EINECS |
251-577-2 |
Moleculaire Structuur |
|
Dichtheid |
1.223g/cm3 |
Smeltpunt |
222-226℃ |
Kookpunt |
257.772°C at 760 mmHg |
Brekingsindex |
1.56 |
Vlampunt |
121.4°C |
Dampdruk |
0.023mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|