ChemNet > CAS > 3365-85-3 4,4''-Diamino-p-terphenyl
3365-85-3 4,4''-Diamino-p-terphenyl
| Naam product |
4,4''-Diamino-p-terphenyl |
| Engelse naam |
4,4''-Diamino-p-terphenyl; 4,4''-Diaminoterphenyl; CCRIS 4965; (1,1':4',1''-Terphenyl)-4,4''-diamine; p,p'-Diaminoterphenyl |
| MF |
C18H16N2 |
| Molecuulgewicht |
260.333 |
| InChI |
InChI=1/C18H16N2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H,19-20H2 |
| CAS-nummer |
3365-85-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.159g/cm3 |
| Kookpunt |
484.2°C at 760 mmHg |
| Brekingsindex |
1.67 |
| Vlampunt |
296.3°C |
| Dampdruk |
1.57E-09mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| Veiligheid Omschrijving |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
