ChemNet > CAS > 3368-21-6 4-Isopropylcinnamic acid
3368-21-6 4-Isopropylcinnamic acid
| Naam product |
4-Isopropylcinnamic acid |
| Engelse naam |
4-Isopropylcinnamic acid;p-Isopropylcinnamic acid; AI3-23710; Cinnamic acid, p-isopropyl-; NSC 216; 2-Propenoic acid, 3-(4-(1-methylethyl)phenyl)-; (2E)-3-[4-(1-methylethyl)phenyl]prop-2-enoate |
| MF |
C12H13O2 |
| Molecuulgewicht |
189.231 |
| InChI |
InChI=1/C12H14O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3-9H,1-2H3,(H,13,14)/p-1/b8-5+ |
| CAS-nummer |
3368-21-6 |
| EINECS |
222-138-2 |
| Moleculaire Structuur |
|
| Kookpunt |
317°C at 760 mmHg |
| Vlampunt |
221.5°C |
| Dampdruk |
0.000167mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
