ChemNet > CAS > 337508-56-2 1-(broommethyl)isochinolinehydrobromide
337508-56-2 1-(broommethyl)isochinolinehydrobromide
Naam product |
1-(broommethyl)isochinolinehydrobromide |
Engelse naam |
1-(bromomethyl)isoquinoline hydrobromide; |
MF |
C10H9Br2N |
Molecuulgewicht |
302.9932 |
InChI |
InChI=1/C10H8BrN.BrH/c11-7-10-9-4-2-1-3-8(9)5-6-12-10;/h1-6H,7H2;1H |
CAS-nummer |
337508-56-2 |
Moleculaire Structuur |
|
Smeltpunt |
180℃ |
Kookpunt |
322.1°C at 760 mmHg |
Vlampunt |
148.6°C |
Dampdruk |
0.000536mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|