ChemNet > CAS > 337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
Naam product |
2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
Engelse naam |
2,3-dihydro-1,4-benzodioxine-6-carbothioamide; 2,3-dihydro-4-Benzodioxin-6-carbothioamide |
MF |
C9H9NO2S |
Molecuulgewicht |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
CAS-nummer |
337508-71-1 |
Moleculaire Structuur |
|
Dichtheid |
1.347g/cm3 |
Smeltpunt |
140.2℃ |
Kookpunt |
339.2°C at 760 mmHg |
Brekingsindex |
1.655 |
Vlampunt |
158.9°C |
Dampdruk |
9.35E-05mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|