ChemNet > CAS > 33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
| Naam product |
3,4-Dimethoxyphenyl isothiocyanate |
| Engelse naam |
3,4-Dimethoxyphenyl isothiocyanate; 3,4-Dimethoxyisothiocyanatobenzene; 4-isothiocyanato-1,2-dimethoxybenzene |
| MF |
C9H9NO2S |
| Molecuulgewicht |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
| CAS-nummer |
33904-04-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.12g/cm3 |
| Smeltpunt |
47-172℃ |
| Kookpunt |
311°C at 760 mmHg |
| Brekingsindex |
1.537 |
| Vlampunt |
141.9°C |
| Dampdruk |
0.00106mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
