ChemNet > CAS > 33907-47-0 hydroxyoctadecaanzuur, monoester met propaan-1,2-diol
33907-47-0 hydroxyoctadecaanzuur, monoester met propaan-1,2-diol
| Naam product |
hydroxyoctadecaanzuur, monoester met propaan-1,2-diol |
| Synoniemen |
Octadecaanzuur, 12-hydroxy-, monoester met 1,2-propaandiol; Propyleenglycolhydroxystearaat; Hydroxyoctadecaanzuur, monoester met propaan-1,2-diol; 2-hydroxyoctadecanoaat; propaan-1,2-diol |
| Engelse naam |
hydroxyoctadecanoic acid, monoester with propane-1,2-diol;Octadecanoic acid, 12-hydroxy-, monoester with 1,2-propanediol; Propylene glycol hydroxystearate; Hydroxyoctadecanoic acid, monoester with propane-1,2-diol; 2-hydroxyoctadecanoate; propane-1,2-diol |
| MF |
C21H43O5 |
| Molecuulgewicht |
375.5637 |
| InChI |
InChI=1/C18H36O3.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;1-3(5)2-4/h17,19H,2-16H2,1H3,(H,20,21);3-5H,2H2,1H3/p-1 |
| CAS-nummer |
33907-47-0 |
| EINECS |
251-734-5 |
| Moleculaire Structuur |
|
| Kookpunt |
432.6°C at 760 mmHg |
| Vlampunt |
229.6°C |
| Dampdruk |
2.67E-09mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
