ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
Naam product |
phenyl(4-pyridyl)methanol |
Engelse naam |
phenyl(4-pyridyl)methanol;alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
MF |
C12H11NO |
Molecuulgewicht |
185.2218 |
InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
CAS-nummer |
33974-27-5 |
EINECS |
251-770-1 |
Moleculaire Structuur |
|
Dichtheid |
1.155g/cm3 |
Smeltpunt |
120℃ |
Kookpunt |
353.5°C at 760 mmHg |
Brekingsindex |
1.604 |
Vlampunt |
167.6°C |
Dampdruk |
1.32E-05mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|