ChemNet > CAS > 342394-00-7 ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate
342394-00-7 ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate
Naam product |
ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate |
Engelse naam |
ethyl 2-(benzylamino)-1,3-thiazole-5-carboxylate; |
MF |
C13H14N2O2S |
Molecuulgewicht |
262.3275 |
InChI |
InChI=1/C13H14N2O2S/c1-2-17-12(16)11-9-15-13(18-11)14-8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,14,15) |
CAS-nummer |
342394-00-7 |
Moleculaire Structuur |
|
Dichtheid |
1.269g/cm3 |
Kookpunt |
410.6°C at 760 mmHg |
Brekingsindex |
1.626 |
Vlampunt |
202.1°C |
Dampdruk |
5.97E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|