ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
| Naam product |
2-Phenylethyl-1-boronic acid |
| Engelse naam |
2-Phenylethyl-1-boronic acid; Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
| MF |
C8H9BO2 |
| Molecuulgewicht |
147.9669 |
| InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
| CAS-nummer |
34420-17-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.13g/cm3 |
| Kookpunt |
315.9°C at 760 mmHg |
| Brekingsindex |
1.587 |
| Vlampunt |
144.9°C |
| Dampdruk |
0.000179mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
