ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
| Naam product |
3,3'-difluorobenzophenone |
| Engelse naam |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
| MF |
C13H8F2O |
| Molecuulgewicht |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| CAS-nummer |
345-70-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.239g/cm3 |
| Smeltpunt |
56-59℃ |
| Kookpunt |
316.2°C at 760 mmHg |
| Brekingsindex |
1.549 |
| Vlampunt |
121.3°C |
| Dampdruk |
0.000415mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
