ChemNet > CAS > 3468-17-5 6-(Aminomethyl)indole
3468-17-5 6-(Aminomethyl)indole
| Naam product |
6-(Aminomethyl)indole |
| Engelse naam |
6-(Aminomethyl)indole; INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
| MF |
C9H10N2 |
| Molecuulgewicht |
146.1891 |
| InChI |
InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
| CAS-nummer |
3468-17-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.2g/cm3 |
| Kookpunt |
335.599°C at 760 mmHg |
| Brekingsindex |
1.698 |
| Vlampunt |
183.277°C |
| Dampdruk |
0mmHg at 25°C |
| Gevaarsymbolen |
 Xi:;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
