ChemNet > CAS > 3469-26-9 2,7-Dimethoxynaphthalene
3469-26-9 2,7-Dimethoxynaphthalene
| Naam product |
2,7-Dimethoxynaphthalene |
| Engelse naam |
2,7-Dimethoxynaphthalene; 2,7-dimethoxyl Naphthalene |
| MF |
C12H12O2 |
| Molecuulgewicht |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
| CAS-nummer |
3469-26-9 |
| EINECS |
222-433-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.097g/cm3 |
| Smeltpunt |
137-139℃ |
| Kookpunt |
311.2°C at 760 mmHg |
| Brekingsindex |
1.584 |
| Vlampunt |
130.3°C |
| Dampdruk |
0.00105mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
