ChemNet > CAS > 35354-29-1 3,5-Diacetoxy Benzoic Acid
35354-29-1 3,5-Diacetoxy Benzoic Acid
| Naam product |
3,5-Diacetoxy Benzoic Acid |
| Engelse naam |
3,5-Diacetoxy Benzoic Acid; 3,5-Diacetoxybenzoic acid; 3,5-bis(acetyloxy)benzoic acid |
| MF |
C11H10O6 |
| Molecuulgewicht |
238.1935 |
| InChI |
InChI=1/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| CAS-nummer |
35354-29-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.344g/cm3 |
| Kookpunt |
408.4°C at 760 mmHg |
| Brekingsindex |
1.543 |
| Vlampunt |
160.4°C |
| Dampdruk |
2.1E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
