ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
Naam product |
3,4-Dichlorophenethylalcohol |
Engelse naam |
3,4-Dichlorophenethylalcohol; 2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
MF |
C8H8Cl2O |
Molecuulgewicht |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
CAS-nummer |
35364-79-5 |
Moleculaire Structuur |
|
Dichtheid |
1.329g/cm3 |
Kookpunt |
279.1°C at 760 mmHg |
Brekingsindex |
1.569 |
Vlampunt |
117.9°C |
Dampdruk |
0.00196mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|