ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
Naam product |
1,4-cyclohexanedimethanol dibenzoate |
Engelse naam |
1,4-cyclohexanedimethanol dibenzoate; 1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
MF |
C22H24O4 |
Molecuulgewicht |
352.4236 |
InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
CAS-nummer |
35541-81-2 |
Moleculaire Structuur |
|
Dichtheid |
1.125g/cm3 |
Kookpunt |
472.9°C at 760 mmHg |
Brekingsindex |
1.549 |
Vlampunt |
233.7°C |
Dampdruk |
4.13E-09mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|