ChemNet > CAS > 36192-63-9 2-Amino-4'-methylbenzophenone
36192-63-9 2-Amino-4'-methylbenzophenone
Naam product |
2-Amino-4'-methylbenzophenone |
Engelse naam |
2-Amino-4'-methylbenzophenone;2-Amino-4'-methylbenzophenone m; (2-aminophenyl)(4-methylphenyl)methanone |
MF |
C14H13NO |
Molecuulgewicht |
211.2591 |
InChI |
InChI=1/C14H13NO/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15/h2-9H,15H2,1H3 |
CAS-nummer |
36192-63-9 |
EINECS |
252-905-7 |
Moleculaire Structuur |
|
Dichtheid |
1.135g/cm3 |
Smeltpunt |
91-94℃ |
Kookpunt |
407.1°C at 760 mmHg |
Brekingsindex |
1.616 |
Vlampunt |
200°C |
Dampdruk |
7.75E-07mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|