ChemNet > CAS > 36304-40-2 2-Chlorophenoxyacetic acid hydrazide
36304-40-2 2-Chlorophenoxyacetic acid hydrazide
| Naam product |
2-Chlorophenoxyacetic acid hydrazide |
| Engelse naam |
2-Chlorophenoxyacetic acid hydrazide; ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
| MF |
C8H9ClN2O2 |
| Molecuulgewicht |
200.6223 |
| InChI |
InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| CAS-nummer |
36304-40-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.324g/cm3 |
| Kookpunt |
419.8°C at 760 mmHg |
| Brekingsindex |
1.568 |
| Vlampunt |
207.7°C |
| Dampdruk |
2.95E-07mmHg at 25°C |
| Gevaarsymbolen |
 Xi:;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
