ChemNet > CAS > 3694-45-9 4-Chlorobenzyl isothiocyanate
3694-45-9 4-Chlorobenzyl isothiocyanate
| Naam product |
4-Chlorobenzyl isothiocyanate |
| Engelse naam |
4-Chlorobenzyl isothiocyanate;Benzene, 1-chloro-4-(isothiocyanatomethyl)- (9CI); 4-12-00-02373 (Beilstein Handbook Reference); BRN 2085917; Isothiocyanic acid, p-chlorobenzyl ester; NSC 221238; Toluene, p-chloro-alpha-isothiocyanato- (6CI); p-Chlorobenzyl isothiocyanate; 1-chloro-4-(isothiocyanatomethyl)benzene |
| MF |
C8H6ClNS |
| Molecuulgewicht |
183.6579 |
| InChI |
InChI=1/C8H6ClNS/c9-8-3-1-7(2-4-8)5-10-6-11/h1-4H,5H2 |
| CAS-nummer |
3694-45-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.18g/cm3 |
| Kookpunt |
278.7°C at 760 mmHg |
| Brekingsindex |
1.581 |
| Vlampunt |
122.4°C |
| Dampdruk |
0.0071mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
